CAS 898793-32-3

Methanone, (2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two phenyl rings, one of which is substituted with a fluorine atom. The presence of a piperidinylmethyl group indicates that it has a piperidine ring, which is a six-membered nitrogen-containing heterocycle, contributing to its potential biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The fluorine substitution can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Methanone derivatives often find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to modulate biological pathways. However, specific information regarding its solubility, stability, and reactivity would require empirical data or literature references for a comprehensive understanding of its characteristics.

Formula: C₁₉H₂₀FNO

InChI: InChI=1S/C19H20FNO/c20-18-10-3-2-9-17(18)19(22)16-8-6-7-15(13-16)14-21-11-4-1-5-12-21/h2-3,6-10,13H,1,4-5,11-12,14H2

InChI key: InChIKey=KNUXWEHZLMMZHE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(F)C=CC=C3

Synonyms:

• (2-Fluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-
• 2-Fluoro-3′-piperidinomethyl benzophenone

2-fluoro-3′-piperidinomethyl benzophenone

CAS: 898793-32-3

Formula: C₁₉H₂₀FNO

Purity: 97.0%

Molecular weight: 297.373

Ref: 10-F204742