CAS 898793-33-4
:1-(2,4-difluorophenyl)-3-(2,3-dimethylphenyl)propan-1-one
Description:
1-(2,4-Difluorophenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898793-33-4, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a propan-1-one backbone substituted with a 2,4-difluorophenyl group and a 2,3-dimethylphenyl group, contributing to its unique chemical properties. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. The dimethyl substitution on the phenyl ring can affect steric hindrance and electronic distribution, potentially impacting its interactions in chemical reactions or biological systems. This compound may exhibit interesting properties such as varying solubility in organic solvents, and its structural features suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C17H16F2O
InChI:InChI=1/C17H16F2O/c1-11-4-3-5-13(12(11)2)6-9-17(20)15-8-7-14(18)10-16(15)19/h3-5,7-8,10H,6,9H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2ccc(cc2F)F)c1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.