CAS 898793-34-5
:Methanone, [3-(1-piperidinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-
Description:
Methanone, [3-(1-piperidinylmethyl)phenyl][2-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. One of the phenyl rings is substituted with a trifluoromethyl group, which enhances its lipophilicity and can influence its biological activity. The presence of a piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as moderate to high stability under standard conditions, and its solubility can vary based on the solvent used, typically being more soluble in organic solvents due to its hydrophobic characteristics. The trifluoromethyl group is known to impart unique electronic properties, potentially affecting the compound's reactivity and interaction with other molecules. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity would require further investigation.
Formula:C20H20F3NO
InChI:InChI=1/C20H20F3NO/c21-20(22,23)18-10-3-2-9-17(18)19(25)16-8-6-7-15(13-16)14-24-11-4-1-5-12-24/h2-3,6-10,13H,1,4-5,11-12,14H2
InChI key:InChIKey=ROOUZWKSHJZISN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(F)(F)F)C=CC=C1)C2=CC(CN3CCCCC3)=CC=C2
Synonyms:- Methanone, [3-(1-piperidinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-
- 3′-Piperidinomethyl-2-trifluoromethylbenzophenone
- (3-(Piperidin-1-ylmethyl)phenyl)(2-(trifluoromethyl)phenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.