CAS 898793-35-6

1-(3,4-difluorophenyl)-3-(2,3-dimethylphenyl)propan-1-one

Description:

1-(3,4-Difluorophenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898793-35-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone, which is substituted with a 3,4-difluorophenyl group and a 2,3-dimethylphenyl group. The presence of fluorine atoms in the aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. The dimethyl substitution on the second phenyl ring contributes to steric hindrance, which may affect the compound's interactions in biological systems. This compound is likely to be a solid at room temperature, given its structural complexity and the presence of multiple aromatic rings. It may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. However, specific solubility, melting point, and other physical properties would need to be determined experimentally or sourced from detailed chemical databases.

Formula: C₁₇H₁₆F₂O

InChI: InChI=1/C17H16F2O/c1-11-4-3-5-13(12(11)2)7-9-17(20)14-6-8-15(18)16(19)10-14/h3-6,8,10H,7,9H2,1-2H3