CAS 898793-36-7
:Methanone, [3-(1-piperidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-
Description:
Methanone, specifically the compound known as [3-(1-piperidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]- (CAS number 898793-36-7), is a synthetic organic compound characterized by its complex structure that includes a piperidine moiety and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. Additionally, the piperidine ring can influence the compound's pharmacological properties, potentially acting as a binding site for various biological targets. Methanone derivatives are often studied for their applications in drug development, particularly in the fields of neuropharmacology and anti-cancer research. As with many synthetic compounds, the specific characteristics such as solubility, melting point, and reactivity can vary based on the surrounding conditions and the presence of other functional groups.
Formula:C20H20F3NO
InChI:InChI=1S/C20H20F3NO/c21-20(22,23)18-9-5-8-17(13-18)19(25)16-7-4-6-15(12-16)14-24-10-2-1-3-11-24/h4-9,12-13H,1-3,10-11,14H2
InChI key:InChIKey=AHKXKHXZHVVBTD-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC(C(F)(F)F)=CC=C3
Synonyms:- 3′-Piperidinomethyl-3-trifluoromethylbenzophenone
- Methanone, [3-(1-piperidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]-
- [3-(1-Piperidinylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.