CymitQuimica logo

CAS 898793-39-0

:

3-(2,3-dimethylphenyl)-1-(3,4,5-trifluorophenyl)propan-1-one

Description:
3-(2,3-Dimethylphenyl)-1-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898793-39-0, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with two distinct aromatic groups: a dimethylphenyl group and a trifluorophenyl group. The presence of the trifluoromethyl groups introduces significant electronegativity, which can influence the compound's reactivity and polarity. The dimethyl substitution on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its interactions in chemical reactions. This compound may exhibit properties typical of ketones, such as being a liquid at room temperature and having a characteristic odor. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C17H15F3O
InChI:InChI=1/C17H15F3O/c1-10-4-3-5-12(11(10)2)6-7-16(21)13-8-14(18)17(20)15(19)9-13/h3-5,8-9H,6-7H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2cc(c(c(c2)F)F)F)c1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.