CAS 898793-40-3

Methanone, (4-bromo-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-bromo-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom and a fluorine atom on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and interactions with biological systems. The piperidinylmethyl group suggests that this compound may exhibit significant pharmacological activity, as piperidine derivatives are often found in various pharmaceuticals. The molecular structure indicates potential for hydrogen bonding and dipole interactions due to the electronegative halogens and the nitrogen in the piperidine ring. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many halogenated compounds, considerations regarding environmental impact and safety during handling are essential.

Formula: C₁₉H₁₉BrFNO

InChI: InChI=1S/C19H19BrFNO/c20-16-7-8-17(18(21)12-16)19(23)15-6-4-5-14(11-15)13-22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10,13H2

InChI key: InChIKey=FWNRQUCAAFIQQZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Br)C=C1)C2=CC(CN3CCCCC3)=CC=C2

Synonyms:

• Methanone, (4-bromo-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-
• (4-Bromo-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone