CAS 898793-41-4
:1-(2,6-dichlorophenyl)-3-(2,3-dimethylphenyl)propan-1-one
Description:
1-(2,6-Dichlorophenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898793-41-4, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with two distinct aromatic rings: one containing two chlorine atoms at the 2 and 6 positions, and the other bearing two methyl groups at the 2 and 3 positions. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as melting point and solubility that depend on its molecular structure and substituents. The presence of the dichlorophenyl and dimethylphenyl groups suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound's structure may influence its reactivity, stability, and interaction with biological systems, making it of interest in medicinal chemistry and material science. Safety data should be consulted for handling and usage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-5-3-6-13(12(11)2)9-10-16(20)17-14(18)7-4-8-15(17)19/h3-8H,9-10H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2c(cccc2Cl)Cl)c1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.