CAS 898793-42-5

Methanone, (2-chloro-4-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-chloro-4-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The piperidinylmethyl group indicates that this compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. The compound's CAS number, 898793-42-5, allows for easy identification and retrieval of information in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various applications, particularly in the field of medicinal chemistry.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1S/C19H19ClFNO/c20-18-12-16(21)7-8-17(18)19(23)15-6-4-5-14(11-15)13-22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10,13H2

InChI key: InChIKey=BTZUMFDJTXQZGN-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC(CN3CCCCC3)=CC=C2

Synonyms:

• Methanone, (2-chloro-4-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-
• (2-Chloro-4-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone