CymitQuimica logo

CAS 898793-43-6

:

1-Cyclopropyl-3-(2,3-dimethylphenyl)-1-propanone

Description:
1-Cyclopropyl-3-(2,3-dimethylphenyl)-1-propanone, with the CAS number 898793-43-6, is an organic compound characterized by its unique structure that includes a cyclopropyl group and a ketone functional group. This compound features a propanone backbone, which is a three-carbon chain with a carbonyl group (C=O) at one end, and is substituted with a cyclopropyl ring and a 2,3-dimethylphenyl group. The presence of the cyclopropyl moiety contributes to its potential reactivity and steric properties, while the dimethylphenyl group enhances its hydrophobic characteristics. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions of its functional groups and overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and reactivity.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-10-4-3-5-12(11(10)2)8-9-14(15)13-6-7-13/h3-5,13H,6-9H2,1-2H3
InChI key:InChIKey=NRXPSTWUGXOMSV-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CC1)C2=C(C)C(C)=CC=C2
Synonyms:
  • 1-Cyclopropyl-3-(2,3-dimethylphenyl)-1-propanone
  • 1-Propanone, 1-cyclopropyl-3-(2,3-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.