CymitQuimica logo

CAS 898793-44-7

:

(3-chloro-5-fluoro-phenyl)-[3-(1-piperidylmethyl)phenyl]methanone

Description:
The chemical substance known as (3-chloro-5-fluoro-phenyl)-[3-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898793-44-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a piperidine moiety. This compound typically exhibits properties associated with aromatic ketones, such as potential reactivity in electrophilic substitution reactions due to the presence of electron-withdrawing groups. The piperidine ring contributes to its potential biological activity, possibly influencing its pharmacological properties. The presence of halogen substituents can enhance lipophilicity and affect the compound's interaction with biological targets. Additionally, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific receptors or enzymes. As with many synthetic compounds, safety and handling precautions should be observed, given the potential toxicity associated with halogenated organic compounds.
Formula:C19H19ClFNO
InChI:InChI=1/C19H19ClFNO/c20-17-10-16(11-18(21)12-17)19(23)15-6-4-5-14(9-15)13-22-7-2-1-3-8-22/h4-6,9-12H,1-3,7-8,13H2
SMILES:C1CCN(CC1)Cc1cccc(c1)C(=O)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.