CAS 898793-46-9

Methanone, (4-chloro-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-chloro and a 2-fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound also features a piperidinylmethyl group, which may enhance its solubility and interaction with biological targets. Typically, such compounds are studied for their potential pharmacological properties, including their role as intermediates in drug synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may exhibit specific interactions with biological receptors, making it of interest in medicinal chemistry. Additionally, the presence of halogen atoms (chlorine and fluorine) often influences the compound's lipophilicity and metabolic stability, which are critical factors in drug design and development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in the field of chemistry.

Formula: C₁₉H₁₉ClFNO

InChI: InChI=1S/C19H19ClFNO/c20-16-7-8-17(18(21)12-16)19(23)15-6-4-5-14(11-15)13-22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10,13H2

InChI key: InChIKey=IMZHBYDGMVKPID-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Cl)C=C1)C2=CC(CN3CCCCC3)=CC=C2

Synonyms:

• Methanone, (4-chloro-2-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

4-chloro-2-fluoro-3′-piperidinomethyl benzophenone

CAS: 898793-46-9

Formula: C₁₉H₁₉ClFNO

Purity: 97.0%

Molecular weight: 331.82

Ref: 10-F204749