CAS 898793-47-0
:1-Cyclopentyl-3-(2,3-dimethylphenyl)-1-propanone
Description:
1-Cyclopentyl-3-(2,3-dimethylphenyl)-1-propanone, identified by its CAS number 898793-47-0, is an organic compound that belongs to the class of ketones. It features a cyclopentyl group and a substituted phenyl group, which contribute to its unique structural and chemical properties. The presence of the ketone functional group indicates that it has a carbonyl (C=O) moiety, which is characteristic of ketones and influences its reactivity and interactions with other substances. This compound is likely to be a solid at room temperature, given its molecular structure, and may exhibit moderate solubility in organic solvents. Its potential applications could span various fields, including organic synthesis and medicinal chemistry, where it may serve as an intermediate or a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled. Further studies would be necessary to fully elucidate its biological activity and potential uses.
Formula:C16H22O
InChI:InChI=1S/C16H22O/c1-12-6-5-9-14(13(12)2)10-11-16(17)15-7-3-4-8-15/h5-6,9,15H,3-4,7-8,10-11H2,1-2H3
InChI key:InChIKey=DWXSFFHIIVRILK-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCCC1)C2=C(C)C(C)=CC=C2
Synonyms:- 1-Propanone, 1-cyclopentyl-3-(2,3-dimethylphenyl)-
- 1-Cyclopentyl-3-(2,3-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.