CAS 898793-48-1
:Methanone, (2,3-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]-
Description:
Methanone, (2,3-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties related to piperidine derivatives, potentially affecting its pharmacological profile. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic nature. Its molecular structure may confer specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of halogen atoms can enhance lipophilicity, influencing the compound's distribution in biological systems. Overall, this compound's unique characteristics may make it a candidate for further research in drug development or other applications in chemistry and pharmacology.
Formula:C19H19Cl2NO
InChI:InChI=1S/C19H19Cl2NO/c20-17-9-5-8-16(18(17)21)19(23)15-7-4-6-14(12-15)13-22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2
InChI key:InChIKey=XCEFCQPNEYFTAJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(Cl)C(Cl)=CC=C3
Synonyms:- Methanone, (2,3-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]-
- 2,3-Dichloro-3′-piperidinomethyl benzophenone
- (2,3-Dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.