CAS 898793-51-6
:1-Propanone, 3-(2,4-dimethylphenyl)-1-phenyl-
Description:
1-Propanone, 3-(2,4-dimethylphenyl)-1-phenyl-, also known by its CAS number 898793-51-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic rings, specifically a phenyl group and a 2,4-dimethylphenyl group, which contribute to its unique chemical properties. The presence of these bulky aromatic substituents can influence the compound's reactivity, solubility, and stability. Typically, ketones like this compound exhibit moderate polarity due to the carbonyl group, which can engage in hydrogen bonding with other polar molecules. The compound may be used in various applications, including organic synthesis and as an intermediate in the production of other chemicals. Its physical properties, such as boiling point and melting point, would be influenced by the molecular structure and the presence of the aromatic rings. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H18O
InChI:InChI=1S/C17H18O/c1-13-8-9-15(14(2)12-13)10-11-17(18)16-6-4-3-5-7-16/h3-9,12H,10-11H2,1-2H3
InChI key:InChIKey=VPEAIEHPQUJBMF-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=CC=C1)C2=C(C)C=C(C)C=C2
Synonyms:- 3-(2,4-Dimethylphenyl)-1-phenylpropan-1-one
- 1-Propanone, 3-(2,4-dimethylphenyl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.