CAS 898793-56-1

Methanone, (3,5-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that chlorine atoms are substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. Additionally, the incorporation of a piperidinylmethyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or pathways. However, detailed studies would be necessary to fully understand its pharmacokinetics, toxicity, and therapeutic potential. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of halogen substituents, which can pose environmental and health risks.

Formula: C₁₉H₁₉Cl₂NO

InChI: InChI=1S/C19H19Cl2NO/c20-17-10-16(11-18(21)12-17)19(23)15-6-4-5-14(9-15)13-22-7-2-1-3-8-22/h4-6,9-12H,1-3,7-8,13H2

InChI key: InChIKey=LDNFVHDAOOBCIF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(CN3CCCCC3)=CC=C2

Synonyms:

• 3,5-Dichloro-3′-piperidinomethyl benzophenone
• Methanone, (3,5-dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]-
• (3,5-Dichlorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone