CAS 898793-60-7

Methanone, (3,4-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,4-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 3,4-difluorophenyl group indicates that the compound has two fluorine substituents on the aromatic ring, which can influence its electronic properties and reactivity. The piperidinylmethyl substituent adds a piperidine ring, a six-membered nitrogen-containing heterocycle, which contributes to the compound's potential biological activity and solubility characteristics. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the fluorine atoms, which can enhance lipophilicity and alter binding affinities in biological systems. Overall, the unique combination of functional groups and substituents in this compound suggests potential applications in drug development and research.

Formula: C₁₉H₁₉F₂NO

InChI: InChI=1S/C19H19F2NO/c20-17-8-7-16(12-18(17)21)19(23)15-6-4-5-14(11-15)13-22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10,13H2

InChI key: InChIKey=JLZJAYUNRAEWFA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC(F)=C(F)C=C3

Synonyms:

• (3,4-Difluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• 3,4-Difluoro-3′-piperidinomethyl benzophenone
• Methanone, (3,4-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]-