CAS 898793-62-9

Methanone, (3,5-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 3,5-difluorophenyl group indicates that the compound has fluorine substituents at the 3 and 5 positions of the phenyl ring, which can influence its electronic properties and reactivity. The second aromatic ring is substituted with a piperidinylmethyl group, suggesting potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit specific physical properties such as solubility and melting point, which are influenced by its molecular structure and substituents. Additionally, the presence of fluorine atoms often enhances lipophilicity and metabolic stability, which can be advantageous in drug design. Overall, the unique combination of functional groups and substituents in this compound may contribute to its potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₉H₁₉F₂NO

InChI: InChI=1S/C19H19F2NO/c20-17-10-16(11-18(21)12-17)19(23)15-6-4-5-14(9-15)13-22-7-2-1-3-8-22/h4-6,9-12H,1-3,7-8,13H2

InChI key: InChIKey=WWQYXMDZOYXDOT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC(CN3CCCCC3)=CC=C2

Synonyms:

• (3,5-Difluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• 3,5-Difluoro-3′-piperidinomethyl benzophenone
• Methanone, (3,5-difluorophenyl)[3-(1-piperidinylmethyl)phenyl]-

3,5-difluoro-3′-piperidinomethyl benzophenone

CAS: 898793-62-9

Formula: C₁₉H₁₉F₂NO

Purity: 97.0%

Molecular weight: 315.364

Ref: 10-F204757