CymitQuimica logo

CAS 898793-66-3

:

cyclopropyl-[3-(1-piperidylmethyl)phenyl]methanone

Description:
Cyclopropyl-[3-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898793-66-3, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenyl ring substituted at the 3-position with a piperidylmethyl group, indicating the presence of a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This structure suggests potential biological activity, as piperidine derivatives are often associated with pharmacological properties. The methanone functional group indicates the presence of a carbonyl (C=O) moiety, which can influence the compound's reactivity and interactions with biological targets. Overall, the combination of these functional groups may contribute to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical data for a comprehensive understanding.
Formula:C16H21NO
InChI:InChI=1/C16H21NO/c18-16(14-7-8-14)15-6-4-5-13(11-15)12-17-9-2-1-3-10-17/h4-6,11,14H,1-3,7-10,12H2
InChI key:InChIKey=QHXWDMBQYVMWDA-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3CC3
Synonyms:
  • Methanone, cyclopropyl[3-(1-piperidinylmethyl)phenyl]-
  • Cyclopropyl[3-(1-piperidinylmethyl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.