CAS 898793-68-5
:Cyclobutyl[3-(1-piperidinylmethyl)phenyl]methanone
Description:
Cyclobutyl[3-(1-piperidinylmethyl)phenyl]methanone, identified by its CAS number 898793-68-5, is a chemical compound characterized by its unique structure that includes a cyclobutyl group, a phenyl ring, and a piperidine moiety. This compound typically exhibits properties associated with both cyclic and aromatic systems, which may influence its reactivity and interactions. The presence of the piperidine ring suggests potential for biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. The methanone functional group indicates that it contains a carbonyl group, which can participate in various chemical reactions, such as nucleophilic addition. The overall molecular structure may contribute to its lipophilicity, affecting solubility and permeability in biological systems. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are often studied for their potential applications in medicinal chemistry and drug development.
Formula:C17H23NO
InChI:InChI=1S/C17H23NO/c19-17(15-7-5-8-15)16-9-4-6-14(12-16)13-18-10-2-1-3-11-18/h4,6,9,12,15H,1-3,5,7-8,10-11,13H2
InChI key:InChIKey=BTUBPGBTQNHCTF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3CCC3
Synonyms:- Cyclobutyl[3-(1-piperidinylmethyl)phenyl]methanone
- Methanone, cyclobutyl[3-(1-piperidinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.