CAS 898793-70-9
:Cyclopentyl[3-(1-piperidinylmethyl)phenyl]methanone
Description:
Cyclopentyl[3-(1-piperidinylmethyl)phenyl]methanone, identified by its CAS number 898793-70-9, is a chemical compound characterized by its unique structure that includes a cyclopentyl group, a piperidinylmethyl substituent, and a phenyl ring. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It may possess moderate to high lipophilicity due to the presence of the cyclopentyl and phenyl groups, which can influence its solubility in organic solvents. The piperidine moiety may impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, Cyclopentyl[3-(1-piperidinylmethyl)phenyl]methanone represents a compound with diverse applications in research and industry.
Formula:C18H25NO
InChI:InChI=1S/C18H25NO/c20-18(16-8-2-3-9-16)17-10-6-7-15(13-17)14-19-11-4-1-5-12-19/h6-7,10,13,16H,1-5,8-9,11-12,14H2
InChI key:InChIKey=DDBFOLNWQQHJQR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3CCCC3
Synonyms:- Cyclopentyl[3-(1-piperidinylmethyl)phenyl]methanone
- Methanone, cyclopentyl[3-(1-piperidinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.