CAS 898793-76-5

ethyl 4-[3-(2,4-dimethylphenyl)propanoyl]benzoate

Description:

Ethyl 4-[3-(2,4-dimethylphenyl)propanoyl]benzoate, identified by its CAS number 898793-76-5, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a complex structure that includes a benzoate moiety and a propanoyl group attached to a dimethyl-substituted phenyl ring. The presence of the ethyl group contributes to its solubility in organic solvents, making it useful in various chemical applications. The compound's molecular structure suggests potential applications in fields such as pharmaceuticals, where it may serve as an intermediate in the synthesis of biologically active molecules. Additionally, the presence of multiple aromatic rings may impart unique electronic properties, influencing its reactivity and interaction with other chemical species. Overall, ethyl 4-[3-(2,4-dimethylphenyl)propanoyl]benzoate is a compound of interest due to its structural complexity and potential utility in organic synthesis.

Formula: C₂₀H₂₂O₃

InChI: InChI=1/C20H22O3/c1-4-23-20(22)18-9-7-17(8-10-18)19(21)12-11-16-6-5-14(2)13-15(16)3/h5-10,13H,4,11-12H2,1-3H3

SMILES: CCOC(=O)c1ccc(cc1)C(=O)CCc1ccc(C)cc1C