CymitQuimica logo

CAS 898793-77-6

:

ethyl 5-oxo-5-[3-(1-piperidylmethyl)phenyl]pentanoate

Description:
Ethyl 5-oxo-5-[3-(1-piperidylmethyl)phenyl]pentanoate, with the CAS number 898793-77-6, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a piperidine moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound may participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Its specific applications and reactivity would depend on the context of its use in research or industry, particularly in medicinal chemistry or as an intermediate in organic synthesis.
Formula:C19H27NO3
InChI:InChI=1/C19H27NO3/c1-2-23-19(22)11-7-10-18(21)17-9-6-8-16(14-17)15-20-12-4-3-5-13-20/h6,8-9,14H,2-5,7,10-13,15H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1cccc(c1)CN1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.