CymitQuimica logo

CAS 898793-79-8

:

3-(2,4-dimethylphenyl)-1-(2-methylsulfanylphenyl)propan-1-one

Description:
3-(2,4-Dimethylphenyl)-1-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898793-79-8, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 2,4-dimethylphenyl group and a 2-methylsulfanylphenyl group. The presence of the methylsulfanyl group introduces a sulfur atom into the molecular structure, which can influence its reactivity and physical properties. Typically, compounds like this may exhibit moderate to high lipophilicity due to their aromatic nature, potentially affecting their solubility in various solvents. The compound may also possess interesting biological activities, making it of interest in pharmaceutical and chemical research. Its synthesis and handling require standard laboratory safety protocols, as with many organic compounds. Overall, the unique combination of functional groups and structural features contributes to its potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C18H20OS
InChI:InChI=1/C18H20OS/c1-13-8-9-15(14(2)12-13)10-11-17(19)16-6-4-5-7-18(16)20-3/h4-9,12H,10-11H2,1-3H3
SMILES:Cc1ccc(CCC(=O)c2ccccc2SC)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.