CAS 898793-80-1

ethyl 6-oxo-6-[3-(1-piperidylmethyl)phenyl]hexanoate

Description:

Ethyl 6-oxo-6-[3-(1-piperidylmethyl)phenyl]hexanoate, with the CAS number 898793-80-1, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a piperidine moiety. This compound typically exhibits properties associated with esters, such as being a liquid at room temperature and having a characteristic fruity odor. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, its solubility in organic solvents and moderate polarity may influence its behavior in biological systems and its application in synthetic chemistry. Overall, ethyl 6-oxo-6-[3-(1-piperidylmethyl)phenyl]hexanoate represents a versatile compound with potential applications in medicinal chemistry and organic synthesis.

Formula: C₂₀H₂₉NO₃

InChI: InChI=1/C20H29NO3/c1-2-24-20(23)12-5-4-11-19(22)18-10-8-9-17(15-18)16-21-13-6-3-7-14-21/h8-10,15H,2-7,11-14,16H2,1H3

SMILES: CCOC(=O)CCCCC(=O)c1cccc(c1)CN1CCCCC1