CAS 898793-84-5

1-Propanone, 1-(3-bromophenyl)-3-(2,4-dimethylphenyl)-

Description:

1-Propanone, 1-(3-bromophenyl)-3-(2,4-dimethylphenyl)-, also known by its CAS number 898793-84-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a dimethylphenyl group. The presence of the bromine atom introduces notable electrophilic properties, potentially influencing its reactivity and interactions in chemical reactions. The dimethyl groups on the phenyl ring contribute to steric hindrance, which can affect the compound's physical properties, such as boiling point and solubility. Generally, compounds of this type may exhibit moderate to high lipophilicity due to their aromatic nature, which can influence their behavior in biological systems and their applications in organic synthesis. Additionally, the compound's structural complexity may allow for diverse reactivity patterns, making it of interest in various fields, including medicinal chemistry and materials science.

Formula: C₁₇H₁₇BrO

InChI: InChI=1S/C17H17BrO/c1-12-6-7-14(13(2)10-12)8-9-17(19)15-4-3-5-16(18)11-15/h3-7,10-11H,8-9H2,1-2H3

InChI key: InChIKey=CVNSJDFPOBBIIN-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=C(C)C=C1)(=O)C2=CC(Br)=CC=C2

Synonyms:

• 1-Propanone, 1-(3-bromophenyl)-3-(2,4-dimethylphenyl)-
• 3′-Bromo-3-(2,4-dimethylphenyl)propiophenone
• 1-(3-Bromophenyl)-3-(2,4-dimethylphenyl)-1-propanone