CAS 898793-85-6

ethyl 8-oxo-8-[3-(1-piperidylmethyl)phenyl]octanoate

Description:

Ethyl 8-oxo-8-[3-(1-piperidylmethyl)phenyl]octanoate, identified by its CAS number 898793-85-6, is a synthetic organic compound characterized by its complex structure, which includes an octanoate backbone, a ketone functional group, and a piperidine moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar, which can influence its solubility in organic solvents. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound may also demonstrate moderate to high lipophilicity due to its long hydrocarbon chain, which can affect its absorption and distribution in biological systems. Additionally, the presence of the ketone group may impart reactivity, making it a candidate for further chemical modifications or reactions. Overall, ethyl 8-oxo-8-[3-(1-piperidylmethyl)phenyl]octanoate is of interest in research contexts, particularly in drug development and organic synthesis.

Formula: C₂₂H₃₃NO₃

InChI: InChI=1/C22H33NO3/c1-2-26-22(25)14-7-4-3-6-13-21(24)20-12-10-11-19(17-20)18-23-15-8-5-9-16-23/h10-12,17H,2-9,13-16,18H2,1H3

SMILES: CCOC(=O)CCCCCCC(=O)c1cccc(c1)CN1CCCCC1