CAS 898793-87-8

1-(4-bromophenyl)-3-(2,4-dimethylphenyl)propan-1-one

Description:

1-(4-bromophenyl)-3-(2,4-dimethylphenyl)propan-1-one, with the CAS number 898793-87-8, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where a bromophenyl group is attached to one end and a dimethylphenyl group is attached to the other. The presence of the bromine atom introduces notable electronegative characteristics, which can influence the compound's reactivity and interactions. The dimethyl substituents on the phenyl ring contribute to steric hindrance and can affect the compound's physical properties, such as solubility and melting point. Typically, compounds of this nature are studied for their potential applications in organic synthesis, pharmaceuticals, or as intermediates in various chemical reactions. The specific arrangement of substituents can also impact the compound's biological activity, making it of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.

Formula: C₁₇H₁₇BrO

InChI: InChI=1/C17H17BrO/c1-12-3-4-14(13(2)11-12)7-10-17(19)15-5-8-16(18)9-6-15/h3-6,8-9,11H,7,10H2,1-2H3

SMILES: Cc1ccc(CCC(=O)c2ccc(cc2)Br)c(C)c1