CymitQuimica logo

CAS 898793-91-4

:

Methanone, (2-methylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:
Methanone, (2-methylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a pyrrolidine moiety suggests that it may exhibit properties associated with cyclic amines, potentially influencing its biological activity. The compound's molecular framework indicates it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological targets. Its solubility, stability, and reactivity would depend on the specific functional groups and their arrangement within the molecule. Additionally, the compound's CAS number, 898793-91-4, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in various chemical contexts. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields, including drug development and materials science.
Formula:C19H21NO
InChI:InChI=1S/C19H21NO/c1-15-7-2-3-10-18(15)19(21)17-9-6-8-16(13-17)14-20-11-4-5-12-20/h2-3,6-10,13H,4-5,11-12,14H2,1H3
InChI key:InChIKey=LORWFFGGNYWDIR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=C(C)C=CC=C3
Synonyms:
  • Methanone, (2-methylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
  • (2-Methylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
  • 2-Methyl-3′-pyrrolidinomethyl benzophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.