CAS 898793-93-6
:1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one
Description:
1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one, also known by its CAS number 898793-93-6, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a para-chlorophenyl group and a dimethyl-substituted phenyl group. The presence of the chlorine atom on the aromatic ring can influence the compound's reactivity and physical properties, such as solubility and boiling point. The dimethyl groups on the second phenyl ring contribute to steric hindrance, which may affect the compound's interactions in chemical reactions. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular structure and the interactions between the functional groups present. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C17H17ClO
InChI:InChI=1/C17H17ClO/c1-12-3-4-14(13(2)11-12)7-10-17(19)15-5-8-16(18)9-6-15/h3-6,8-9,11H,7,10H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2ccc(cc2)Cl)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.