CAS 898793-94-7
:m-tolyl-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
m-Tolyl-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, identified by its CAS number 898793-94-7, is a chemical compound that features a complex structure comprising a tolyl group, a pyrrolidine moiety, and a ketone functional group. This compound is characterized by its aromatic nature due to the presence of phenyl rings, which contribute to its stability and potential reactivity. The pyrrolidine ring introduces a cyclic amine structure, which can influence the compound's biological activity and solubility. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential interactions with biological targets. The presence of the ketone group suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the specific arrangement of substituents can affect the compound's polarity, melting point, and boiling point, which are important for its application in research and industry. Overall, m-tolyl-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone represents a class of organic compounds with diverse potential applications in pharmaceuticals and materials science.
Formula:C19H21NO
InChI:InChI=1/C19H21NO/c1-15-6-4-8-17(12-15)19(21)18-9-5-7-16(13-18)14-20-10-2-3-11-20/h4-9,12-13H,2-3,10-11,14H2,1H3
SMILES:Cc1cccc(c1)C(=O)c1cccc(c1)CN1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.