CymitQuimica logo

CAS 898793-99-2

:

3-(2,4-dimethylphenyl)-1-(4-fluorophenyl)propan-1-one

Description:
3-(2,4-Dimethylphenyl)-1-(4-fluorophenyl)propan-1-one, identified by its CAS number 898793-99-2, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 2,4-dimethylphenyl group and a 4-fluorophenyl group. The presence of these substituents contributes to its unique physical and chemical properties, including its potential solubility in organic solvents and its reactivity in various chemical reactions. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-donating effects of the methyl groups and the electron-withdrawing effect of the fluorine atom. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of its substituents, which may affect its applications in synthetic organic chemistry.
Formula:C17H17FO
InChI:InChI=1/C17H17FO/c1-12-3-4-14(13(2)11-12)7-10-17(19)15-5-8-16(18)9-6-15/h3-6,8-9,11H,7,10H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2ccc(cc2)F)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.