CAS 898794-02-0

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,4-dimethylphenyl)-

Description:

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,4-dimethylphenyl)-, also known by its CAS number 898794-02-0, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 2,4-dimethylphenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, including potential variations in solubility, boiling point, and reactivity compared to simpler ketones. Typically, compounds of this nature may exhibit moderate volatility and can be used in various applications, including organic synthesis and as intermediates in the production of more complex molecules. Additionally, the presence of multiple methyl groups can influence the compound's steric hindrance and electronic properties, which may affect its behavior in chemical reactions. Safety data and handling precautions should be considered, as with all chemical substances, to ensure proper usage and minimize risks.

Formula: C₁₉H₂₂O

InChI: InChI=1S/C19H22O/c1-13-8-9-17(15(3)12-13)10-11-19(20)18-7-5-6-14(2)16(18)4/h5-9,12H,10-11H2,1-4H3

InChI key: InChIKey=FHEVCTWICVJZSL-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=C(C)C=C1)(=O)C2=C(C)C(C)=CC=C2

Synonyms:

• 1-(2,3-Dimethylphenyl)-3-(2,4-dimethylphenyl)-1-propanone
• 1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,4-dimethylphenyl)-
• 2′,3′-Dimethyl-3-(2,4-dimethylphenyl)propiophenone

2′,3′-dimethyl-3-(2,4-dimethylphenyl)propiophenone

CAS: 898794-02-0

Formula: C₁₉H₂₂O

Purity: 97.0%

Molecular weight: 266.384

Ref: 10-F206433