CAS 898794-06-4

Methanone, (4-methoxyphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-methoxyphenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a methoxy group on one of the phenyl rings enhances its solubility and reactivity. The pyrrolidinylmethyl substituent introduces a cyclic amine, which can influence the compound's biological activity and interaction with various receptors. This compound is likely to exhibit properties typical of both ketones and aromatic compounds, such as potential reactivity in electrophilic substitution reactions. Its molecular structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often associated with psychoactive properties. Additionally, the compound's unique arrangement of functional groups may contribute to its specificity in biological systems, making it a subject of interest for further research in drug design and synthesis. However, detailed studies would be necessary to fully understand its properties and potential applications.

Formula: C₁₉H₂₁NO₂

InChI: InChI=1S/C19H21NO2/c1-22-18-9-7-16(8-10-18)19(21)17-6-4-5-15(13-17)14-20-11-2-3-12-20/h4-10,13H,2-3,11-12,14H2,1H3

InChI key: InChIKey=MRRDXGCFSJVULR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC=C(OC)C=C3

Synonyms:

• (4-Methoxyphenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (4-methoxyphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

4′-methoxy-3-pyrrolidinomethyl benzophenone

CAS: 898794-06-4

Formula: C₁₉H₂₁NO₂

Purity: 97.0%

Molecular weight: 295.382

Ref: 10-F204774