CAS 898794-08-6
:3-(2,4-dimethylphenyl)-1-(2,5-dimethylphenyl)propan-1-one
Description:
3-(2,4-Dimethylphenyl)-1-(2,5-dimethylphenyl)propan-1-one, identified by its CAS number 898794-08-6, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two substituted aromatic rings, which contribute to its unique chemical properties. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic character and may influence its reactivity and solubility in organic solvents. Typically, compounds like this exhibit moderate to high melting and boiling points due to the presence of aromatic systems, which can also lead to significant stability under standard conditions. Additionally, the compound may exhibit interesting photochemical properties, making it potentially useful in applications such as organic synthesis, materials science, or as a precursor in the production of other chemical entities. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-6-8-17(16(4)11-13)9-10-19(20)18-12-14(2)5-7-15(18)3/h5-8,11-12H,9-10H2,1-4H3
SMILES:Cc1ccc(CCC(=O)c2cc(C)ccc2C)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.