CAS 898794-12-2

3-[3-(pyrrolidin-1-ylmethyl)benzoyl]benzonitrile

Description:

3-[3-(Pyrrolidin-1-ylmethyl)benzoyl]benzonitrile, with the CAS number 898794-12-2, is a chemical compound that features a complex structure comprising a benzoyl group and a benzonitrile moiety, linked through a pyrrolidine substituent. This compound is characterized by its aromatic rings, which contribute to its stability and potential interactions in biological systems. The presence of the pyrrolidine ring suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the nitrile functional group (–C≡N) can impart unique reactivity and polarity, making it useful in various chemical reactions and applications. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. Overall, this compound represents a versatile structure that could be explored for various chemical and biological applications.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1/C19H18N2O/c20-13-15-5-3-7-17(11-15)19(22)18-8-4-6-16(12-18)14-21-9-1-2-10-21/h3-8,11-12H,1-2,9-10,14H2

SMILES: C1CCN(C1)Cc1cccc(c1)C(=O)c1cccc(c1)C#N