CymitQuimica logo

CAS 898794-14-4

:

3-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)propan-1-one

Description:
3-(2,4-Dimethylphenyl)-1-(3,4-dimethylphenyl)propan-1-one, identified by its CAS number 898794-14-4, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic rings substituted with methyl groups, contributing to its complex structure and potential reactivity. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. This compound may exhibit interesting chemical properties, such as potential reactivity in electrophilic aromatic substitution reactions due to the electron-donating effects of the methyl groups. Additionally, it may have applications in organic synthesis or as an intermediate in the production of other chemical compounds. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure. Overall, its unique structure and properties make it a subject of interest in various chemical research fields.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-5-7-17(16(4)11-13)9-10-19(20)18-8-6-14(2)15(3)12-18/h5-8,11-12H,9-10H2,1-4H3
SMILES:Cc1ccc(CCC(=O)c2ccc(C)c(C)c2)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.