CAS 898794-15-5

4-[3-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

Description:

4-[3-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile, with the CAS number 898794-15-5, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a pyrrolidine ring, which contributes to its potential biological activity and solubility properties. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can influence their interaction with biological systems. The presence of the nitrile group may also impart unique reactivity and stability characteristics. In terms of applications, compounds like this are often explored in medicinal chemistry for their potential as pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. The specific characteristics, such as melting point, solubility, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of organic molecules that may have significant implications in drug discovery and development.

Formula: C₁₉H₁₈N₂O

InChI: InChI=1S/C19H18N2O/c20-13-15-6-8-17(9-7-15)19(22)18-5-3-4-16(12-18)14-21-10-1-2-11-21/h3-9,12H,1-2,10-11,14H2

InChI key: InChIKey=KDAWGPVTTPEYAL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC=C(C#N)C=C3

Synonyms:

• Benzonitrile, 4-[3-(1-pyrrolidinylmethyl)benzoyl]-
• 4-[3-(1-Pyrrolidinylmethyl)benzoyl]benzonitrile

4′-cyano-3-pyrrolidinomethyl benzophenone

CAS: 898794-15-5

Formula: C₁₉H₁₈N₂O

Purity: 97.0%

Molecular weight: 290.366

Ref: 10-F204777