CAS 898794-18-8

Ethyl 2-[3-(1-pyrrolidinylmethyl)benzoyl]benzoate

Description:

Ethyl 2-[3-(1-pyrrolidinylmethyl)benzoyl]benzoate, identified by its CAS number 898794-18-8, is an organic compound characterized by its complex structure, which includes an ethyl ester group and a benzoyl moiety linked to a pyrrolidine derivative. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the pyrrolidine ring suggests potential biological activity, as many pyrrolidine derivatives are known for their pharmacological properties. Ethyl 2-[3-(1-pyrrolidinylmethyl)benzoyl]benzoate may be utilized in various applications, including medicinal chemistry and as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₂₁H₂₃NO₃

InChI: InChI=1S/C21H23NO3/c1-2-25-21(24)19-11-4-3-10-18(19)20(23)17-9-7-8-16(14-17)15-22-12-5-6-13-22/h3-4,7-11,14H,2,5-6,12-13,15H2,1H3

InChI key: InChIKey=XDDJANKCZWHGIL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(OCC)=O)C=CC=C1)C2=CC(CN3CCCC3)=CC=C2

Synonyms:

• Benzoic acid, 2-[3-(1-pyrrolidinylmethyl)benzoyl]-, ethyl ester
• Ethyl 2-[3-(1-pyrrolidinylmethyl)benzoyl]benzoate

2-carboethoxy-3′-pyrrolidinomethyl benzophenone

CAS: 898794-18-8

Formula: C₂₁H₂₃NO₃

Purity: 97.0%

Molecular weight: 337.419

Ref: 10-F204778