CAS 898794-22-4

1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,4-dimethylphenyl)-

Description:

1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,4-dimethylphenyl)-, also known by its CAS number 898794-22-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chloro-3-fluorophenyl group and a 2,4-dimethylphenyl group. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity and physical properties, including its boiling point and solubility. The compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, which can affect its interactions in various chemical environments. Additionally, the presence of multiple methyl groups in the dimethylphenyl substituent may enhance steric hindrance, potentially influencing its reactivity and interactions with other molecules. As with many organic compounds, safety data should be consulted for handling and usage, as the presence of halogens can pose specific health and environmental risks.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-3-4-13(12(2)9-11)6-8-17(20)14-5-7-15(18)16(19)10-14/h3-5,7,9-10H,6,8H2,1-2H3

InChI key: InChIKey=KHFQEPSTYJDQBA-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=C(C)C=C1)(=O)C2=CC(F)=C(Cl)C=C2

Synonyms:

• 1-(4-Chloro-3-fluorophenyl)-3-(2,4-dimethylphenyl)-1-propanone
• 4′-Chloro-3-(2,4-dimethylphenyl)-3′-fluoropropiophenone
• 1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,4-dimethylphenyl)-

4′-chloro-3-(2,4-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898794-22-4

Formula: C₁₇H₁₆ClFO

Purity: 97.0%

Molecular weight: 290.76

Ref: 10-F206440