CymitQuimica logo

CAS 898794-28-0

:

1-Propanone, 3-(2,4-dimethylphenyl)-1-(2-fluorophenyl)-

Description:
1-Propanone, 3-(2,4-dimethylphenyl)-1-(2-fluorophenyl)-, also known by its CAS number 898794-28-0, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,4-dimethylphenyl group and a 2-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in reactivity and solubility compared to simpler ketones. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its reactivity in certain chemical reactions. Additionally, the presence of methyl groups on the aromatic ring can affect steric hindrance and overall molecular stability. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would need to be determined through experimental data.
Formula:C17H17FO
InChI:InChI=1S/C17H17FO/c1-12-7-8-14(13(2)11-12)9-10-17(19)15-5-3-4-6-16(15)18/h3-8,11H,9-10H2,1-2H3
InChI key:InChIKey=DRUORFQLOSNBRF-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=C(C)C=C1)(=O)C2=C(F)C=CC=C2
Synonyms:
  • 1-Propanone, 3-(2,4-dimethylphenyl)-1-(2-fluorophenyl)-
  • 3-(2,4-Dimethylphenyl)-1-(2-fluorophenyl)-1-propanone
  • 3-(2,4-Dimethylphenyl)-2′-fluoropropiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.