CymitQuimica logo

CAS 898794-30-4

:

1-Propanone, 3-(2,4-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:
1-Propanone, 3-(2,4-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,4-dimethylphenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions in various chemical environments. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. It may exhibit moderate to high stability under standard conditions but could be sensitive to strong oxidizing agents. Additionally, due to the presence of fluorine atoms, it may have unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C18H17F3O
InChI:InChI=1S/C18H17F3O/c1-12-7-8-14(13(2)11-12)9-10-17(22)15-5-3-4-6-16(15)18(19,20)21/h3-8,11H,9-10H2,1-2H3
InChI key:InChIKey=GSJIRNIXYAHVMP-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=C(C)C=C1)(=O)C2=C(C(F)(F)F)C=CC=C2
Synonyms:
  • 1-Propanone, 3-(2,4-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]-
  • 3-(2,4-Dimethylphenyl)-2′-trifluoromethyl-propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.