CAS 898794-36-0

1-(4-bromo-2-fluoro-phenyl)-3-(2,4-dimethylphenyl)propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3-(2,4-dimethylphenyl)propan-1-one, with the CAS number 898794-36-0, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a bromo and a fluoro group on the phenyl rings. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen atoms (bromine and fluorine) can influence the compound's electronic properties, making it potentially useful in medicinal chemistry and material science. Additionally, the dimethyl substitution on one of the phenyl rings may enhance its lipophilicity, affecting its solubility and biological activity. The compound's unique structural features suggest it may exhibit interesting chemical behavior, including potential interactions with biological targets or use as a building block in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₇H₁₆BrFO

InChI: InChI=1/C17H16BrFO/c1-11-3-4-13(12(2)9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3

SMILES: Cc1ccc(CCC(=O)c2ccc(cc2F)Br)c(C)c1