CymitQuimica logo

CAS 898794-42-8

:

1-(4-chloro-2-fluoro-phenyl)-3-(2,4-dimethylphenyl)propan-1-one

Description:
1-(4-chloro-2-fluoro-phenyl)-3-(2,4-dimethylphenyl)propan-1-one, with the CAS number 898794-42-8, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone substituted with a 4-chloro-2-fluorophenyl group and a 2,4-dimethylphenyl group, contributing to its unique chemical properties. The presence of halogen atoms, specifically chlorine and fluorine, enhances its reactivity and may influence its biological activity. The compound is likely to exhibit moderate to high lipophilicity due to the bulky aromatic substituents, which can affect its solubility in organic solvents. Additionally, the structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and handling would require standard laboratory safety protocols due to the presence of halogens, which can pose health risks. Overall, this compound represents a class of substituted phenyl ketones that may have significant implications in various chemical research fields.
Formula:C17H16ClFO
InChI:InChI=1/C17H16ClFO/c1-11-3-4-13(12(2)9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2ccc(cc2F)Cl)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.