CymitQuimica logo

CAS 898794-48-4

:

1-(2,5-dichlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one

Description:
1-(2,5-Dichlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one, with the CAS number 898794-48-4, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structures. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple substituents can influence its physical properties, such as melting point, boiling point, and reactivity, making it a subject of interest for further research in various chemical fields. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-3-4-13(12(2)9-11)5-8-17(20)15-10-14(18)6-7-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2cc(ccc2Cl)Cl)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.