CAS 898794-50-8
:1-(3,4-dichlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one
Description:
1-(3,4-Dichlorophenyl)-3-(2,4-dimethylphenyl)propan-1-one, with the CAS number 898794-50-8, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a dichlorophenyl group and a dimethylphenyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. This compound is typically characterized by its solid state at room temperature, with a specific melting point and boiling point that can vary based on purity and environmental conditions. It is often analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to determine its structure and purity. The compound may have applications in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. However, safety and handling precautions are essential, as with many organic compounds, to mitigate any risks associated with exposure or environmental impact.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-3-4-13(12(2)9-11)6-8-17(20)14-5-7-15(18)16(19)10-14/h3-5,7,9-10H,6,8H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2ccc(c(c2)Cl)Cl)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.