CAS 898794-66-6
:1-Cyclobutyl-3-(2,4-dimethylphenyl)-1-propanone
Description:
1-Cyclobutyl-3-(2,4-dimethylphenyl)-1-propanone, with the CAS number 898794-66-6, is an organic compound that belongs to the class of ketones. It features a cyclobutyl group and a 2,4-dimethylphenyl substituent, contributing to its unique structural characteristics. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively low volatility due to its molecular structure. It is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the cyclobutyl ring can impart distinctive reactivity patterns, while the aromatic substituent may influence its electronic properties and stability. Additionally, 1-Cyclobutyl-3-(2,4-dimethylphenyl)-1-propanone may exhibit specific solubility characteristics, being soluble in organic solvents but less so in water. Safety data indicates that, like many organic compounds, it should be handled with care, utilizing appropriate safety measures to mitigate risks associated with chemical exposure.
Formula:C15H20O
InChI:InChI=1S/C15H20O/c1-11-6-7-13(12(2)10-11)8-9-15(16)14-4-3-5-14/h6-7,10,14H,3-5,8-9H2,1-2H3
InChI key:InChIKey=WKNYPOBNOQEYTM-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCC1)C2=C(C)C=C(C)C=C2
Synonyms:- 1-Cyclobutyl-3-(2,4-dimethylphenyl)-1-propanone
- 1-Propanone, 1-cyclobutyl-3-(2,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.