CAS 898794-70-2
:1-Cyclohexyl-3-(2,4-dimethylphenyl)-1-propanone
Description:
1-Cyclohexyl-3-(2,4-dimethylphenyl)-1-propanone, with the CAS number 898794-70-2, is an organic compound primarily used in the field of organic synthesis and as a photoinitiator in polymer chemistry. This substance features a cyclohexyl group and a 2,4-dimethylphenyl moiety attached to a propanone structure, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The compound is known for its ability to absorb ultraviolet light, which facilitates the initiation of polymerization processes when exposed to UV radiation. Its solubility characteristics generally allow it to dissolve in organic solvents, making it suitable for various applications in coatings, adhesives, and inks. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety and stability.
Formula:C17H24O
InChI:InChI=1S/C17H24O/c1-13-8-9-15(14(2)12-13)10-11-17(18)16-6-4-3-5-7-16/h8-9,12,16H,3-7,10-11H2,1-2H3
InChI key:InChIKey=LZWHAMVGCFTGLE-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCCCC1)C2=C(C)C=C(C)C=C2
Synonyms:- 1-Cyclohexyl-3-(2,4-dimethylphenyl)-1-propanone
- 1-Propanone, 1-cyclohexyl-3-(2,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.