CAS 898794-94-0

Ethyl 3-[3-(2,5-dimethylphenyl)-1-oxopropyl]benzoate

Description:

Ethyl 3-[3-(2,5-dimethylphenyl)-1-oxopropyl]benzoate, with the CAS number 898794-94-0, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a complex structure that includes a benzoate moiety and a propyl chain substituted with a 2,5-dimethylphenyl group. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, while the ester group enhances its solubility in organic solvents. Ethyl 3-[3-(2,5-dimethylphenyl)-1-oxopropyl]benzoate may exhibit interesting chemical reactivity due to the presence of the carbonyl group, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, its unique structure may impart specific biological activities, making it of interest in pharmaceutical research. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₂₀H₂₂O₃

InChI: InChI=1S/C20H22O3/c1-4-23-20(22)18-7-5-6-17(13-18)19(21)11-10-16-12-14(2)8-9-15(16)3/h5-9,12-13H,4,10-11H2,1-3H3

InChI key: InChIKey=RDYSLCVJMZHUAS-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC(C)=C1)(=O)C2=CC(C(OCC)=O)=CC=C2

Synonyms:

• Benzoic acid, 3-[3-(2,5-dimethylphenyl)-1-oxopropyl]-, ethyl ester
• Ethyl 3-[3-(2,5-dimethylphenyl)-1-oxopropyl]benzoate

3′-carboethoxy-3-(2,5-dimethylphenyl)propiophenone

CAS: 898794-94-0

Formula: C₂₀H₂₂O₃

Purity: 97.0%

Molecular weight: 310.393

Ref: 10-F206476