CAS 898795-02-3

1-(3-bromophenyl)-3-(2,5-dimethylphenyl)propan-1-one

Description:

1-(3-bromophenyl)-3-(2,5-dimethylphenyl)propan-1-one, with the CAS number 898795-02-3, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a bromophenyl group and a dimethylphenyl group, which contribute to its unique chemical properties and potential reactivity. The presence of the bromine atom introduces a halogen, which can influence the compound's electrophilicity and overall stability. The dimethyl substituents on the phenyl ring can affect steric hindrance and electronic distribution, impacting its interactions in chemical reactions. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or reductions, depending on the reaction conditions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₇BrO

InChI: InChI=1/C17H17BrO/c1-12-6-7-13(2)14(10-12)8-9-17(19)15-4-3-5-16(18)11-15/h3-7,10-11H,8-9H2,1-2H3

SMILES: Cc1ccc(C)c(CCC(=O)c2cccc(c2)Br)c1